C11H9F7N2O2S — CID 21238945
2-[2-amino-4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)anilino]acetic acid (PubChem CID 21238945) has the molecular formula C11H9F7N2O2S and a molecular weight of 366.26 g/mol. Its IUPAC name is 2-[2-amino-4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)anilino]acetic acid.
| Compound Name | 2-[2-amino-4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)anilino]acetic acid |
|---|---|
| PubChem CID | 21238945 |
| Molecular Formula | C11H9F7N2O2S |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 2-[2-amino-4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)anilino]acetic acid |
| SMILES | Nc1cc(SC(F)(F)C(F)(F)C(F)(F)F)ccc1NCC(=O)O |
| InChI | InChI=1S/C11H9F7N2O2S/c12-9(13,10(14,15)16)11(17,18)23-5-1-2-7(6(19)3-5)20-4-8(21)22/h1-3,20H,4,19H2,(H,21,22) |
| InChIKey | VQTAXNCVGNXRGJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|