C21H22N2O6S — CID 21240270
1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 3-(4-methyl-1,3-thiazol-2-yl)-4-oxochromene-7-carboxylate (PubChem CID 21240270) has the molecular formula C21H22N2O6S and a molecular weight of 430.48 g/mol. Its IUPAC name is 1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 3-(4-methyl-1,3-thiazol-2-yl)-4-oxochromene-7-carboxylate.
| Compound Name | 1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 3-(4-methyl-1,3-thiazol-2-yl)-4-oxochromene-7-carboxylate |
|---|---|
| PubChem CID | 21240270 |
| Molecular Formula | C21H22N2O6S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 3-(4-methyl-1,3-thiazol-2-yl)-4-oxochromene-7-carboxylate |
| SMILES | Cc1csc(-c2coc3cc(C(=O)OC(C)NC(=O)OC(C)(C)C)ccc3c2=O)n1 |
| InChI | InChI=1S/C21H22N2O6S/c1-11-10-30-18(22-11)15-9-27-16-8-13(6-7-14(16)17(15)24)19(25)28-12(2)23-20(26)29-21(3,4)5/h6-10,12H,1-5H3,(H,23,26) |
| InChIKey | IAQQJOBMKMQDEP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|