C17H25O4- — CID 21242332
(2E,6E)-3,7-dimethyl-9-(2-prop-1-en-2-yl-1,3-dioxolan-2-yl)nona-2,6-dienoate (PubChem CID 21242332) has the molecular formula C17H25O4- and a molecular weight of 293.38 g/mol. Its IUPAC name is (2E,6E)-3,7-dimethyl-9-(2-prop-1-en-2-yl-1,3-dioxolan-2-yl)nona-2,6-dienoate.
| Compound Name | (2E,6E)-3,7-dimethyl-9-(2-prop-1-en-2-yl-1,3-dioxolan-2-yl)nona-2,6-dienoate |
|---|---|
| PubChem CID | 21242332 |
| Molecular Formula | C17H25O4- |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (2E,6E)-3,7-dimethyl-9-(2-prop-1-en-2-yl-1,3-dioxolan-2-yl)nona-2,6-dienoate |
| SMILES | C=C(C)C1(CC/C(C)=C/CC/C(C)=C/C(=O)[O-])OCCO1 |
| InChI | InChI=1S/C17H26O4/c1-13(2)17(20-10-11-21-17)9-8-14(3)6-5-7-15(4)12-16(18)19/h6,12H,1,5,7-11H2,2-4H3,(H,18,19)/p-1/b14-6+,15-12+ |
| InChIKey | XLVHELPANMQFQS-BUJBXKITSA-M |
| XLogP | 2.51 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|