C5H7NO6S — CID 21245024
2-methoxycarbonyl-4-oxoazetidine-1-sulfonic acid (PubChem CID 21245024) has the molecular formula C5H7NO6S and a molecular weight of 209.18 g/mol. Its IUPAC name is 2-methoxycarbonyl-4-oxoazetidine-1-sulfonic acid.
| Compound Name | 2-methoxycarbonyl-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 21245024 |
| Molecular Formula | C5H7NO6S |
| Molecular Weight | 209.18 g/mol |
| Exact Mass | 209.00 |
| IUPAC Name | 2-methoxycarbonyl-4-oxoazetidine-1-sulfonic acid |
| SMILES | COC(=O)C1CC(=O)N1S(=O)(=O)O |
| InChI | InChI=1S/C5H7NO6S/c1-12-5(8)3-2-4(7)6(3)13(9,10)11/h3H,2H2,1H3,(H,9,10,11) |
| InChIKey | FCLOSOQAUACDJG-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.18 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|