C24H50ClP — CID 21245666
tributyl-[(E)-5,5,7,7-tetramethyloct-2-enyl]phosphanium chloride (PubChem CID 21245666) has the molecular formula C24H50ClP and a molecular weight of 405.09 g/mol. Its IUPAC name is tributyl-[(E)-5,5,7,7-tetramethyloct-2-enyl]phosphanium chloride.
| Compound Name | tributyl-[(E)-5,5,7,7-tetramethyloct-2-enyl]phosphanium chloride |
|---|---|
| PubChem CID | 21245666 |
| Molecular Formula | C24H50ClP |
| Molecular Weight | 405.09 g/mol |
| Exact Mass | 404.33 |
| IUPAC Name | tributyl-[(E)-5,5,7,7-tetramethyloct-2-enyl]phosphanium chloride |
| SMILES | CCCC[P+](C/C=C/CC(C)(C)CC(C)(C)C)(CCCC)CCCC.[Cl-] |
| InChI | InChI=1S/C24H50P.ClH/c1-9-12-18-25(19-13-10-2,20-14-11-3)21-16-15-17-24(7,8)22-23(4,5)6;/h15-16H,9-14,17-22H2,1-8H3;1H/q+1;/p-1/b16-15+; |
| InChIKey | IOGUBSKKKJGLTH-GEEYTBSJSA-M |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.09 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|