C30H62Br2P2 — CID 87718023
tributyl-[(2E,4E)-6-tributylphosphaniumylhexa-2,4-dienyl]phosphanium dibromide (PubChem CID 87718023) has the molecular formula C30H62Br2P2 and a molecular weight of 644.58 g/mol. Its IUPAC name is tributyl-[(2E,4E)-6-tributylphosphaniumylhexa-2,4-dienyl]phosphanium dibromide.
| Compound Name | tributyl-[(2E,4E)-6-tributylphosphaniumylhexa-2,4-dienyl]phosphanium dibromide |
|---|---|
| PubChem CID | 87718023 |
| Molecular Formula | C30H62Br2P2 |
| Molecular Weight | 644.58 g/mol |
| Exact Mass | 642.27 |
| IUPAC Name | tributyl-[(2E,4E)-6-tributylphosphaniumylhexa-2,4-dienyl]phosphanium dibromide |
| SMILES | CCCC[P+](C/C=C/C=C/C[P+](CCCC)(CCCC)CCCC)(CCCC)CCCC.[Br-].[Br-] |
| InChI | InChI=1S/C30H62P2.2BrH/c1-7-13-23-31(24-14-8-2,25-15-9-3)29-21-19-20-22-30-32(26-16-10-4,27-17-11-5)28-18-12-6;;/h19-22H,7-18,23-30H2,1-6H3;2*1H/q+2;;/p-2/b21-19+,22-20+;; |
| InChIKey | DIJZBAZSNBCGFC-JXYRNBIZSA-L |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.58 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|