C20H28N4OS — CID 21246392
(3Z)-1-methyl-3-(6-octoxy-1-phenylpyridazin-4-ylidene)thiourea (PubChem CID 21246392) has the molecular formula C20H28N4OS and a molecular weight of 372.54 g/mol. Its IUPAC name is (3Z)-1-methyl-3-(6-octoxy-1-phenylpyridazin-4-ylidene)thiourea.
| Compound Name | (3Z)-1-methyl-3-(6-octoxy-1-phenylpyridazin-4-ylidene)thiourea |
|---|---|
| PubChem CID | 21246392 |
| Molecular Formula | C20H28N4OS |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | (3Z)-1-methyl-3-(6-octoxy-1-phenylpyridazin-4-ylidene)thiourea |
| SMILES | CCCCCCCCOc1c/c(=N/C(=S)NC)cnn1-c1ccccc1 |
| InChI | InChI=1S/C20H28N4OS/c1-3-4-5-6-7-11-14-25-19-15-17(23-20(26)21-2)16-22-24(19)18-12-9-8-10-13-18/h8-10,12-13,15-16H,3-7,11,14H2,1-2H3,(H,21,26)/b23-17- |
| InChIKey | YRIOSSADCAUHHM-QJOMJCCJSA-N |
| XLogP | 4.02 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|