C23H33N3O2 — CID 21246514
2,2-dimethyl-N-(6-octoxy-1-phenylpyridazin-4-ylidene)propanamide (PubChem CID 21246514) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 2,2-dimethyl-N-(6-octoxy-1-phenylpyridazin-4-ylidene)propanamide.
| Compound Name | 2,2-dimethyl-N-(6-octoxy-1-phenylpyridazin-4-ylidene)propanamide |
|---|---|
| PubChem CID | 21246514 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 2,2-dimethyl-N-(6-octoxy-1-phenylpyridazin-4-ylidene)propanamide |
| SMILES | CCCCCCCCOc1c/c(=N/C(=O)C(C)(C)C)cnn1-c1ccccc1 |
| InChI | InChI=1S/C23H33N3O2/c1-5-6-7-8-9-13-16-28-21-17-19(25-22(27)23(2,3)4)18-24-26(21)20-14-11-10-12-15-20/h10-12,14-15,17-18H,5-9,13,16H2,1-4H3/b25-19- |
| InChIKey | LFTGJPWTRFMQTR-PLRJNAJWSA-N |
| XLogP | 5.09 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|