About 3-(4-propylphenyl)oxane
3-(4-propylphenyl)oxane (PubChem CID 21248099) has the molecular formula C14H20O
and a molecular weight of 204.31 g/mol. Its IUPAC name is 3-(4-propylphenyl)oxane.
Molecular Properties
| Compound Name | 3-(4-propylphenyl)oxane |
| PubChem CID | 21248099 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 3-(4-propylphenyl)oxane |
| SMILES | CCCc1ccc(C2CCCOC2)cc1 |
| InChI | InChI=1S/C14H20O/c1-2-4-12-6-8-13(9-7-12)14-5-3-10-15-11-14/h6-9,14H,2-5,10-11H2,1H3 |
| InChIKey | PRWORLLFYAYCRW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(4-propylphenyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-propylphenyl)oxane?
The IUPAC name of 3-(4-propylphenyl)oxane (CID 21248099) is 3-(4-propylphenyl)oxane.
What is the SMILES notation for 3-(4-propylphenyl)oxane?
The canonical SMILES for 3-(4-propylphenyl)oxane is CCCc1ccc(C2CCCOC2)cc1.
What is the InChIKey of 3-(4-propylphenyl)oxane?
The InChIKey is PRWORLLFYAYCRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O/c1-2-4-12-6-8-13(9-7-12)14-5-3-10-15-11-14/h6-9,14H,2-5,10-11H2,1H3.
What are the key properties of 3-(4-propylphenyl)oxane?
3-(4-propylphenyl)oxane has a molecular weight of 204.31 g/mol, XLogP of 3.53, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-propylphenyl)oxane is sourced from PubChem (CID 21248099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).