About 3-[4-(4-methylcyclohexa-1,3-dien-1-yl)phenyl]oxane
3-[4-(4-methylcyclohexa-1,3-dien-1-yl)phenyl]oxane (PubChem CID 143189162) has the molecular formula C18H22O
and a molecular weight of 254.37 g/mol. Its IUPAC name is 3-[4-(4-methylcyclohexa-1,3-dien-1-yl)phenyl]oxane.
Molecular Properties
| Compound Name | 3-[4-(4-methylcyclohexa-1,3-dien-1-yl)phenyl]oxane |
| PubChem CID | 143189162 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 3-[4-(4-methylcyclohexa-1,3-dien-1-yl)phenyl]oxane |
| SMILES | CC1=CC=C(c2ccc(C3CCCOC3)cc2)CC1 |
| InChI | InChI=1S/C18H22O/c1-14-4-6-15(7-5-14)16-8-10-17(11-9-16)18-3-2-12-19-13-18/h4,6,8-11,18H,2-3,5,7,12-13H2,1H3 |
| InChIKey | NTAPSOFVKCMAAU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[4-(4-methylcyclohexa-1,3-dien-1-yl)phenyl]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(4-methylcyclohexa-1,3-dien-1-yl)phenyl]oxane?
The IUPAC name of 3-[4-(4-methylcyclohexa-1,3-dien-1-yl)phenyl]oxane (CID 143189162) is 3-[4-(4-methylcyclohexa-1,3-dien-1-yl)phenyl]oxane.
What is the SMILES notation for 3-[4-(4-methylcyclohexa-1,3-dien-1-yl)phenyl]oxane?
The canonical SMILES for 3-[4-(4-methylcyclohexa-1,3-dien-1-yl)phenyl]oxane is CC1=CC=C(c2ccc(C3CCCOC3)cc2)CC1.
What is the InChIKey of 3-[4-(4-methylcyclohexa-1,3-dien-1-yl)phenyl]oxane?
The InChIKey is NTAPSOFVKCMAAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O/c1-14-4-6-15(7-5-14)16-8-10-17(11-9-16)18-3-2-12-19-13-18/h4,6,8-11,18H,2-3,5,7,12-13H2,1H3.
What are the key properties of 3-[4-(4-methylcyclohexa-1,3-dien-1-yl)phenyl]oxane?
3-[4-(4-methylcyclohexa-1,3-dien-1-yl)phenyl]oxane has a molecular weight of 254.37 g/mol, XLogP of 4.70, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(4-methylcyclohexa-1,3-dien-1-yl)phenyl]oxane is sourced from PubChem (CID 143189162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).