C17H11N5O2 — CID 21250725
5-(2-phenylmethoxyphenyl)triazolo[4,5-d]pyrimidin-7-one (PubChem CID 21250725) has the molecular formula C17H11N5O2 and a molecular weight of 317.31 g/mol. Its IUPAC name is 5-(2-phenylmethoxyphenyl)triazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 5-(2-phenylmethoxyphenyl)triazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 21250725 |
| Molecular Formula | C17H11N5O2 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 5-(2-phenylmethoxyphenyl)triazolo[4,5-d]pyrimidin-7-one |
| SMILES | O=C1N=C(c2ccccc2OCc2ccccc2)N=C2N=NN=C12 |
| InChI | InChI=1S/C17H11N5O2/c23-17-14-16(21-22-20-14)18-15(19-17)12-8-4-5-9-13(12)24-10-11-6-2-1-3-7-11/h1-9H,10H2 |
| InChIKey | ANVQELVNTWIGHE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 88.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |