C8H7ClN2O — CID 21251107
4-(5-chloro-3-pyridinyl)-4,5-dihydro-1,3-oxazole (PubChem CID 21251107) has the molecular formula C8H7ClN2O and a molecular weight of 182.61 g/mol. Its IUPAC name is 4-(5-chloro-3-pyridinyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-(5-chloro-3-pyridinyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 21251107 |
| Molecular Formula | C8H7ClN2O |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | 4-(5-chloro-3-pyridinyl)-4,5-dihydro-1,3-oxazole |
| SMILES | Clc1cncc(C2COC=N2)c1 |
| InChI | InChI=1S/C8H7ClN2O/c9-7-1-6(2-10-3-7)8-4-12-5-11-8/h1-3,5,8H,4H2 |
| InChIKey | PKHSUHOWQIQNQB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |