C16H13Br2NO5 — CID 21252421
dimethyl 5-(4-amino-2,6-dibromophenoxy)benzene-1,3-dicarboxylate (PubChem CID 21252421) has the molecular formula C16H13Br2NO5 and a molecular weight of 459.09 g/mol. Its IUPAC name is dimethyl 5-(4-amino-2,6-dibromophenoxy)benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-(4-amino-2,6-dibromophenoxy)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 21252421 |
| Molecular Formula | C16H13Br2NO5 |
| Molecular Weight | 459.09 g/mol |
| Exact Mass | 456.92 |
| IUPAC Name | dimethyl 5-(4-amino-2,6-dibromophenoxy)benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(Oc2c(Br)cc(N)cc2Br)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C16H13Br2NO5/c1-22-15(20)8-3-9(16(21)23-2)5-11(4-8)24-14-12(17)6-10(19)7-13(14)18/h3-7H,19H2,1-2H3 |
| InChIKey | TUDAPDDTKPMSFT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.09 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|