C18H24N4O — CID 21256754
2-methyl-4-phenyl-6-(3-piperidin-1-ylpropoxy)-1,3,5-triazine (PubChem CID 21256754) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 2-methyl-4-phenyl-6-(3-piperidin-1-ylpropoxy)-1,3,5-triazine.
| Compound Name | 2-methyl-4-phenyl-6-(3-piperidin-1-ylpropoxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 21256754 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 2-methyl-4-phenyl-6-(3-piperidin-1-ylpropoxy)-1,3,5-triazine |
| SMILES | Cc1nc(OCCCN2CCCCC2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H24N4O/c1-15-19-17(16-9-4-2-5-10-16)21-18(20-15)23-14-8-13-22-11-6-3-7-12-22/h2,4-5,9-10H,3,6-8,11-14H2,1H3 |
| InChIKey | ZYMNNZVSUGCMHC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|