C18H25N3O — CID 3070797
1-[3-[(4-methyl-5-phenyl-1H-pyrazol-3-yl)oxy]propyl]piperidine (PubChem CID 3070797) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 1-[3-[(4-methyl-5-phenyl-1H-pyrazol-3-yl)oxy]propyl]piperidine.
| Compound Name | 1-[3-[(4-methyl-5-phenyl-1H-pyrazol-3-yl)oxy]propyl]piperidine |
|---|---|
| PubChem CID | 3070797 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 1-[3-[(4-methyl-5-phenyl-1H-pyrazol-3-yl)oxy]propyl]piperidine |
| SMILES | Cc1c(OCCCN2CCCCC2)n[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C18H25N3O/c1-15-17(16-9-4-2-5-10-16)19-20-18(15)22-14-8-13-21-11-6-3-7-12-21/h2,4-5,9-10H,3,6-8,11-14H2,1H3,(H,19,20) |
| InChIKey | ARNMIOZTOPESRU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|