C19H25N7OS2 — CID 21256944
5-methylsulfanyl-2-[5-[2-(3-piperidin-1-ylpropoxy)phenyl]-1,3,4-thiadiazol-2-yl]-1,2,4-triazol-3-amine (PubChem CID 21256944) has the molecular formula C19H25N7OS2 and a molecular weight of 431.59 g/mol. Its IUPAC name is 5-methylsulfanyl-2-[5-[2-(3-piperidin-1-ylpropoxy)phenyl]-1,3,4-thiadiazol-2-yl]-1,2,4-triazol-3-amine.
| Compound Name | 5-methylsulfanyl-2-[5-[2-(3-piperidin-1-ylpropoxy)phenyl]-1,3,4-thiadiazol-2-yl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 21256944 |
| Molecular Formula | C19H25N7OS2 |
| Molecular Weight | 431.59 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 5-methylsulfanyl-2-[5-[2-(3-piperidin-1-ylpropoxy)phenyl]-1,3,4-thiadiazol-2-yl]-1,2,4-triazol-3-amine |
| SMILES | CSc1nc(N)n(-c2nnc(-c3ccccc3OCCCN3CCCCC3)s2)n1 |
| InChI | InChI=1S/C19H25N7OS2/c1-28-18-21-17(20)26(24-18)19-23-22-16(29-19)14-8-3-4-9-15(14)27-13-7-12-25-10-5-2-6-11-25/h3-4,8-9H,2,5-7,10-13H2,1H3,(H2,20,21,24) |
| InChIKey | YHSSKUPCFJZHPG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.59 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|