C17H22N4O2 — CID 21258156
1-propyl-8-(1-tricyclo[3.3.1.03,7]nonanyl)-3,7-dihydropurine-2,6-dione (PubChem CID 21258156) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 1-propyl-8-(1-tricyclo[3.3.1.03,7]nonanyl)-3,7-dihydropurine-2,6-dione.
| Compound Name | 1-propyl-8-(1-tricyclo[3.3.1.03,7]nonanyl)-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 21258156 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 1-propyl-8-(1-tricyclo[3.3.1.03,7]nonanyl)-3,7-dihydropurine-2,6-dione |
| SMILES | CCCn1c(=O)[nH]c2nc(C34CC5CC(C3)C(C5)C4)[nH]c2c1=O |
| InChI | InChI=1S/C17H22N4O2/c1-2-3-21-14(22)12-13(20-16(21)23)19-15(18-12)17-6-9-4-10(7-17)11(5-9)8-17/h9-11H,2-8H2,1H3,(H,18,19)(H,20,23) |
| InChIKey | VGZCECDCJSAHBA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |