C22H33NO2S — CID 21260073
1-dodecan-4-ylsulfanyl-3-phenylpyrrolidine-2,5-dione (PubChem CID 21260073) has the molecular formula C22H33NO2S and a molecular weight of 375.58 g/mol. Its IUPAC name is 1-dodecan-4-ylsulfanyl-3-phenylpyrrolidine-2,5-dione.
| Compound Name | 1-dodecan-4-ylsulfanyl-3-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 21260073 |
| Molecular Formula | C22H33NO2S |
| Molecular Weight | 375.58 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 1-dodecan-4-ylsulfanyl-3-phenylpyrrolidine-2,5-dione |
| SMILES | CCCCCCCCC(CCC)SN1C(=O)CC(c2ccccc2)C1=O |
| InChI | InChI=1S/C22H33NO2S/c1-3-5-6-7-8-12-16-19(13-4-2)26-23-21(24)17-20(22(23)25)18-14-10-9-11-15-18/h9-11,14-15,19-20H,3-8,12-13,16-17H2,1-2H3 |
| InChIKey | LTUGHGOYRSFXSH-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.58 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|