About sodium;fluoro hypofluorite;phosphate
sodium;fluoro hypofluorite;phosphate (PubChem CID 21260229) has the molecular formula F2NaO5P-2
and a molecular weight of 171.95 g/mol. Its IUPAC name is sodium;fluoro hypofluorite;phosphate.
Molecular Properties
| Compound Name | sodium;fluoro hypofluorite;phosphate |
| PubChem CID | 21260229 |
| Molecular Formula | F2NaO5P-2 |
| Molecular Weight | 171.95 g/mol |
| Exact Mass | 171.94 |
| IUPAC Name | sodium;fluoro hypofluorite;phosphate |
| SMILES | FOF.O=P([O-])([O-])[O-].[Na+] |
| InChI | InChI=1S/F2O.Na.H3O4P/c1-3-2;;1-5(2,3)4/h;;(H3,1,2,3,4)/q;+1;/p-3 |
| InChIKey | NTZNKGOEJAZCGT-UHFFFAOYSA-K |
| XLogP | -5.05 |
| TPSA | 95.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.95 |
| LogP ≤ 5 | -5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;fluoro hypofluorite;phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;fluoro hypofluorite;phosphate?
The IUPAC name of sodium;fluoro hypofluorite;phosphate (CID 21260229) is sodium;fluoro hypofluorite;phosphate.
What is the SMILES notation for sodium;fluoro hypofluorite;phosphate?
The canonical SMILES for sodium;fluoro hypofluorite;phosphate is FOF.O=P([O-])([O-])[O-].[Na+].
What is the InChIKey of sodium;fluoro hypofluorite;phosphate?
The InChIKey is NTZNKGOEJAZCGT-UHFFFAOYSA-K. The full InChI is InChI=1S/F2O.Na.H3O4P/c1-3-2;;1-5(2,3)4/h;;(H3,1,2,3,4)/q;+1;/p-3.
What are the key properties of sodium;fluoro hypofluorite;phosphate?
sodium;fluoro hypofluorite;phosphate has a molecular weight of 171.95 g/mol, XLogP of -5.05, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;fluoro hypofluorite;phosphate is sourced from PubChem (CID 21260229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).