C12H26N2O3S — CID 21263480
2-amino-2-[2-(butylsulfonimidoyl)ethyl]hexanoic acid (PubChem CID 21263480) has the molecular formula C12H26N2O3S and a molecular weight of 278.42 g/mol. Its IUPAC name is 2-amino-2-[2-(butylsulfonimidoyl)ethyl]hexanoic acid.
| Compound Name | 2-amino-2-[2-(butylsulfonimidoyl)ethyl]hexanoic acid |
|---|---|
| PubChem CID | 21263480 |
| Molecular Formula | C12H26N2O3S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2-amino-2-[2-(butylsulfonimidoyl)ethyl]hexanoic acid |
| SMILES | [H]N=S(=O)(CCCC)CCC(N)(CCCC)C(=O)O |
| InChI | InChI=1S/C12H26N2O3S/c1-3-5-7-12(13,11(15)16)8-10-18(14,17)9-6-4-2/h14H,3-10,13H2,1-2H3,(H,15,16) |
| InChIKey | DSSROALCIKLGIT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 104.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |