C16H21F3N4O4 — CID 2126641
[(2S,3R)-3-methyl-1-oxo-1-[2-[2-[3-(trifluoromethyl)phenoxy]acetyl]hydrazinyl]pentan-2-yl]urea (PubChem CID 2126641) has the molecular formula C16H21F3N4O4 and a molecular weight of 390.36 g/mol. Its IUPAC name is [(2S,3R)-3-methyl-1-oxo-1-[2-[2-[3-(trifluoromethyl)phenoxy]acetyl]hydrazinyl]pentan-2-yl]urea.
| Compound Name | [(2S,3R)-3-methyl-1-oxo-1-[2-[2-[3-(trifluoromethyl)phenoxy]acetyl]hydrazinyl]pentan-2-yl]urea |
|---|---|
| PubChem CID | 2126641 |
| Molecular Formula | C16H21F3N4O4 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | [(2S,3R)-3-methyl-1-oxo-1-[2-[2-[3-(trifluoromethyl)phenoxy]acetyl]hydrazinyl]pentan-2-yl]urea |
| SMILES | CC[C@@H](C)[C@H](NC(N)=O)C(=O)NNC(=O)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H21F3N4O4/c1-3-9(2)13(21-15(20)26)14(25)23-22-12(24)8-27-11-6-4-5-10(7-11)16(17,18)19/h4-7,9,13H,3,8H2,1-2H3,(H,22,24)(H,23,25)(H3,20,21,26)/t9-,13+/m1/s1 |
| InChIKey | CQEPDEMGYDUOJD-RNCFNFMXSA-N |
| XLogP | 1.31 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|