C14H12N2S — CID 21269540
5-benzyl-1,3-dihydrobenzimidazole-2-thione (PubChem CID 21269540) has the molecular formula C14H12N2S and a molecular weight of 240.33 g/mol. Its IUPAC name is 5-benzyl-1,3-dihydrobenzimidazole-2-thione.
| Compound Name | 5-benzyl-1,3-dihydrobenzimidazole-2-thione |
|---|---|
| PubChem CID | 21269540 |
| Molecular Formula | C14H12N2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 5-benzyl-1,3-dihydrobenzimidazole-2-thione |
| SMILES | S=c1[nH]c2ccc(Cc3ccccc3)cc2[nH]1 |
| InChI | InChI=1S/C14H12N2S/c17-14-15-12-7-6-11(9-13(12)16-14)8-10-4-2-1-3-5-10/h1-7,9H,8H2,(H2,15,16,17) |
| InChIKey | JJRZUSPQPHTBID-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|