C10H10N2S2 — CID 54479449
4-benzyl-5-sulfanyl-1,3-dihydroimidazole-2-thione (PubChem CID 54479449) has the molecular formula C10H10N2S2 and a molecular weight of 222.34 g/mol. Its IUPAC name is 4-benzyl-5-sulfanyl-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-benzyl-5-sulfanyl-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 54479449 |
| Molecular Formula | C10H10N2S2 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 4-benzyl-5-sulfanyl-1,3-dihydroimidazole-2-thione |
| SMILES | S=c1[nH]c(S)c(Cc2ccccc2)[nH]1 |
| InChI | InChI=1S/C10H10N2S2/c13-9-8(11-10(14)12-9)6-7-4-2-1-3-5-7/h1-5,13H,6H2,(H2,11,12,14) |
| InChIKey | XNYMUXJQGWYODR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|