About CID 21271989
CID 21271989 (PubChem CID 21271989) has the molecular formula H2O5S2-2
and a molecular weight of 146.14 g/mol.
Molecular Properties
| Compound Name | CID 21271989 |
| PubChem CID | 21271989 |
| Molecular Formula | H2O5S2-2 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 145.94 |
| IUPAC Name | — |
| SMILES | O.O=S([O-])S(=O)[O-] |
| InChI | InChI=1S/H2O4S2.H2O/c1-5(2)6(3)4;/h(H,1,2)(H,3,4);1H2/p-2 |
| InChIKey | XTBHOIDDNZAOKU-UHFFFAOYSA-L |
| XLogP | -2.17 |
| TPSA | 111.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze CID 21271989 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 21271989?
The IUPAC name of CID 21271989 (CID 21271989) is not available.
What is the SMILES notation for CID 21271989?
The canonical SMILES for CID 21271989 is O.O=S([O-])S(=O)[O-].
What is the InChIKey of CID 21271989?
The InChIKey is XTBHOIDDNZAOKU-UHFFFAOYSA-L. The full InChI is InChI=1S/H2O4S2.H2O/c1-5(2)6(3)4;/h(H,1,2)(H,3,4);1H2/p-2.
What are the key properties of CID 21271989?
CID 21271989 has a molecular weight of 146.14 g/mol, XLogP of -2.17, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 21271989 is sourced from PubChem (CID 21271989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).