About Zinc dithionite
Zinc dithionite (PubChem CID 24517) has the molecular formula O4S2Zn
and a molecular weight of 193.52 g/mol.
Molecular Properties
| Compound Name | Zinc dithionite |
| PubChem CID | 24517 |
| Molecular Formula | O4S2Zn |
| Molecular Weight | 193.52 g/mol |
| Exact Mass | 191.85 |
| IUPAC Name | — |
| SMILES | O=S([O-])S(=O)[O-].[Zn+2] |
| InChI | InChI=1S/H2O4S2.Zn/c1-5(2)6(3)4;/h(H,1,2)(H,3,4);/q;+2/p-2 |
| InChIKey | PENRVBJTRIYHOA-UHFFFAOYSA-L |
| XLogP | -1.34 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.52 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze Zinc dithionite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Zinc dithionite?
The IUPAC name of Zinc dithionite (CID 24517) is not available.
What is the SMILES notation for Zinc dithionite?
The canonical SMILES for Zinc dithionite is O=S([O-])S(=O)[O-].[Zn+2].
What is the InChIKey of Zinc dithionite?
The InChIKey is PENRVBJTRIYHOA-UHFFFAOYSA-L. The full InChI is InChI=1S/H2O4S2.Zn/c1-5(2)6(3)4;/h(H,1,2)(H,3,4);/q;+2/p-2.
What are the key properties of Zinc dithionite?
Zinc dithionite has a molecular weight of 193.52 g/mol, XLogP of -1.34, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Zinc dithionite is sourced from PubChem (CID 24517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).