C17H17F3N2O5 — CID 21272577
ethyl 4-ethynyl-4-[2-nitro-4-(trifluoromethyl)phenoxy]piperidine-1-carboxylate (PubChem CID 21272577) has the molecular formula C17H17F3N2O5 and a molecular weight of 386.33 g/mol. Its IUPAC name is ethyl 4-ethynyl-4-[2-nitro-4-(trifluoromethyl)phenoxy]piperidine-1-carboxylate.
| Compound Name | ethyl 4-ethynyl-4-[2-nitro-4-(trifluoromethyl)phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 21272577 |
| Molecular Formula | C17H17F3N2O5 |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | ethyl 4-ethynyl-4-[2-nitro-4-(trifluoromethyl)phenoxy]piperidine-1-carboxylate |
| SMILES | C#CC1(Oc2ccc(C(F)(F)F)cc2[N+](=O)[O-])CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C17H17F3N2O5/c1-3-16(7-9-21(10-8-16)15(23)26-4-2)27-14-6-5-12(17(18,19)20)11-13(14)22(24)25/h1,5-6,11H,4,7-10H2,2H3 |
| InChIKey | LFKVFDMDTGLUEF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|