C18H17N5O4S2 — CID 2127340
6-[2-[(3-tert-butyl-4-oxo-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-7-yl)sulfanyl]acetyl]-4H-1,4-benzoxazin-3-one (PubChem CID 2127340) has the molecular formula C18H17N5O4S2 and a molecular weight of 431.50 g/mol. Its IUPAC name is 6-[2-[(3-tert-butyl-4-oxo-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-7-yl)sulfanyl]acetyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-[(3-tert-butyl-4-oxo-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-7-yl)sulfanyl]acetyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 2127340 |
| Molecular Formula | C18H17N5O4S2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 6-[2-[(3-tert-butyl-4-oxo-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-7-yl)sulfanyl]acetyl]-4H-1,4-benzoxazin-3-one |
| SMILES | CC(C)(C)c1nnc2sc(SCC(=O)c3ccc4c(c3)NC(=O)CO4)nn2c1=O |
| InChI | InChI=1S/C18H17N5O4S2/c1-18(2,3)14-15(26)23-16(21-20-14)29-17(22-23)28-8-11(24)9-4-5-12-10(6-9)19-13(25)7-27-12/h4-6H,7-8H2,1-3H3,(H,19,25) |
| InChIKey | GBMGOYRHTBZCNC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 115.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |