C10H9Cl3FN3OS — CID 21275618
4-(2-fluorophenyl)-5-methyl-2-(trichloromethylsulfanyl)-1,2,4-triazolidin-3-one (PubChem CID 21275618) has the molecular formula C10H9Cl3FN3OS and a molecular weight of 344.63 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-5-methyl-2-(trichloromethylsulfanyl)-1,2,4-triazolidin-3-one.
| Compound Name | 4-(2-fluorophenyl)-5-methyl-2-(trichloromethylsulfanyl)-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 21275618 |
| Molecular Formula | C10H9Cl3FN3OS |
| Molecular Weight | 344.63 g/mol |
| Exact Mass | 342.95 |
| IUPAC Name | 4-(2-fluorophenyl)-5-methyl-2-(trichloromethylsulfanyl)-1,2,4-triazolidin-3-one |
| SMILES | CC1NN(SC(Cl)(Cl)Cl)C(=O)N1c1ccccc1F |
| InChI | InChI=1S/C10H9Cl3FN3OS/c1-6-15-17(19-10(11,12)13)9(18)16(6)8-5-3-2-4-7(8)14/h2-6,15H,1H3 |
| InChIKey | INSZDFUMEOHZCM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.63 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|