C10H7Cl3FN3OS — CID 88627717
4-(2-fluorophenyl)-5-oxo-1-(trichloromethyl)-1,2,4-triazolidine-3-carbothialdehyde (PubChem CID 88627717) has the molecular formula C10H7Cl3FN3OS and a molecular weight of 342.61 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-5-oxo-1-(trichloromethyl)-1,2,4-triazolidine-3-carbothialdehyde.
| Compound Name | 4-(2-fluorophenyl)-5-oxo-1-(trichloromethyl)-1,2,4-triazolidine-3-carbothialdehyde |
|---|---|
| PubChem CID | 88627717 |
| Molecular Formula | C10H7Cl3FN3OS |
| Molecular Weight | 342.61 g/mol |
| Exact Mass | 340.94 |
| IUPAC Name | 4-(2-fluorophenyl)-5-oxo-1-(trichloromethyl)-1,2,4-triazolidine-3-carbothialdehyde |
| SMILES | O=C1N(c2ccccc2F)C(C=S)NN1C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H7Cl3FN3OS/c11-10(12,13)17-9(18)16(8(5-19)15-17)7-4-2-1-3-6(7)14/h1-5,8,15H |
| InChIKey | CLTBWGDJMOXQMY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.61 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|