C24H19N3O2 — CID 21277236
(2-benzoyl-5-phenyl-1,2,5-triazepin-1-yl)-phenylmethanone (PubChem CID 21277236) has the molecular formula C24H19N3O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is (2-benzoyl-5-phenyl-1,2,5-triazepin-1-yl)-phenylmethanone.
| Compound Name | (2-benzoyl-5-phenyl-1,2,5-triazepin-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 21277236 |
| Molecular Formula | C24H19N3O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | (2-benzoyl-5-phenyl-1,2,5-triazepin-1-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)n1ccn(-c2ccccc2)ccn1C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H19N3O2/c28-23(20-10-4-1-5-11-20)26-18-16-25(22-14-8-3-9-15-22)17-19-27(26)24(29)21-12-6-2-7-13-21/h1-19H |
| InChIKey | FEPPGLXRFLDKAE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |