C11H18F3N7 — CID 21279840
5-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]pentanimidamide (PubChem CID 21279840) has the molecular formula C11H18F3N7 and a molecular weight of 305.31 g/mol. Its IUPAC name is 5-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]pentanimidamide.
| Compound Name | 5-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]pentanimidamide |
|---|---|
| PubChem CID | 21279840 |
| Molecular Formula | C11H18F3N7 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 5-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]pentanimidamide |
| SMILES | [H]/N=C(\N)CCCCn1ccc(N/C(N)=N/CC(F)(F)F)n1 |
| InChI | InChI=1S/C11H18F3N7/c12-11(13,14)7-18-10(17)19-9-4-6-21(20-9)5-2-1-3-8(15)16/h4,6H,1-3,5,7H2,(H3,15,16)(H3,17,18,19,20) |
| InChIKey | FAFPSEFQZUPEJR-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|