C11H15F3N8 — CID 21279849
N'-cyano-4-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]butanimidamide (PubChem CID 21279849) has the molecular formula C11H15F3N8 and a molecular weight of 316.29 g/mol. Its IUPAC name is N'-cyano-4-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]butanimidamide.
| Compound Name | N'-cyano-4-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]butanimidamide |
|---|---|
| PubChem CID | 21279849 |
| Molecular Formula | C11H15F3N8 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | N'-cyano-4-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]butanimidamide |
| SMILES | N#C/N=C(\N)CCCn1ccc(N/C(N)=N/CC(F)(F)F)n1 |
| InChI | InChI=1S/C11H15F3N8/c12-11(13,14)6-18-10(17)20-9-3-5-22(21-9)4-1-2-8(16)19-7-15/h3,5H,1-2,4,6H2,(H2,16,19)(H3,17,18,20,21) |
| InChIKey | KAQWERNUOGRINB-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 130.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|