C24H26F3NO2 — CID 21280554
6,6,6-trifluoro-2,2-dimethyl-1-[3-(quinolin-4-ylmethoxy)phenyl]hexan-1-ol (PubChem CID 21280554) has the molecular formula C24H26F3NO2 and a molecular weight of 417.47 g/mol. Its IUPAC name is 6,6,6-trifluoro-2,2-dimethyl-1-[3-(quinolin-4-ylmethoxy)phenyl]hexan-1-ol.
| Compound Name | 6,6,6-trifluoro-2,2-dimethyl-1-[3-(quinolin-4-ylmethoxy)phenyl]hexan-1-ol |
|---|---|
| PubChem CID | 21280554 |
| Molecular Formula | C24H26F3NO2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 6,6,6-trifluoro-2,2-dimethyl-1-[3-(quinolin-4-ylmethoxy)phenyl]hexan-1-ol |
| SMILES | CC(C)(CCCC(F)(F)F)C(O)c1cccc(OCc2ccnc3ccccc23)c1 |
| InChI | InChI=1S/C24H26F3NO2/c1-23(2,12-6-13-24(25,26)27)22(29)17-7-5-8-19(15-17)30-16-18-11-14-28-21-10-4-3-9-20(18)21/h3-5,7-11,14-15,22,29H,6,12-13,16H2,1-2H3 |
| InChIKey | FQONKIIJKGGRDA-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |