C17H17F3O2 — CID 83952092
1-[3-[(2,5-dimethylphenyl)methoxy]phenyl]-2,2,2-trifluoroethanol (PubChem CID 83952092) has the molecular formula C17H17F3O2 and a molecular weight of 310.32 g/mol. Its IUPAC name is 1-[3-[(2,5-dimethylphenyl)methoxy]phenyl]-2,2,2-trifluoroethanol.
| Compound Name | 1-[3-[(2,5-dimethylphenyl)methoxy]phenyl]-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 83952092 |
| Molecular Formula | C17H17F3O2 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 1-[3-[(2,5-dimethylphenyl)methoxy]phenyl]-2,2,2-trifluoroethanol |
| SMILES | Cc1ccc(C)c(COc2cccc(C(O)C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C17H17F3O2/c1-11-6-7-12(2)14(8-11)10-22-15-5-3-4-13(9-15)16(21)17(18,19)20/h3-9,16,21H,10H2,1-2H3 |
| InChIKey | RXJXYDKPAYUVSI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |