C17H19NO5S — CID 21280798
3-anthracen-9-yloxypropan-1-amine;sulfuric acid (PubChem CID 21280798) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is 3-anthracen-9-yloxypropan-1-amine;sulfuric acid.
| Compound Name | 3-anthracen-9-yloxypropan-1-amine;sulfuric acid |
|---|---|
| PubChem CID | 21280798 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 3-anthracen-9-yloxypropan-1-amine;sulfuric acid |
| SMILES | NCCCOc1c2ccccc2cc2ccccc12.O=S(=O)(O)O |
| InChI | InChI=1S/C17H17NO.H2O4S/c18-10-5-11-19-17-15-8-3-1-6-13(15)12-14-7-2-4-9-16(14)17;1-5(2,3)4/h1-4,6-9,12H,5,10-11,18H2;(H2,1,2,3,4) |
| InChIKey | GZLNPRYWWXPZLW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|