C18H30N4S2 — CID 21282367
1-(benzotriazol-1-yl)-2,2-bis(butylsulfanyl)butan-1-amine (PubChem CID 21282367) has the molecular formula C18H30N4S2 and a molecular weight of 366.60 g/mol. Its IUPAC name is 1-(benzotriazol-1-yl)-2,2-bis(butylsulfanyl)butan-1-amine.
| Compound Name | 1-(benzotriazol-1-yl)-2,2-bis(butylsulfanyl)butan-1-amine |
|---|---|
| PubChem CID | 21282367 |
| Molecular Formula | C18H30N4S2 |
| Molecular Weight | 366.60 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 1-(benzotriazol-1-yl)-2,2-bis(butylsulfanyl)butan-1-amine |
| SMILES | CCCCSC(CC)(SCCCC)C(N)n1nnc2ccccc21 |
| InChI | InChI=1S/C18H30N4S2/c1-4-7-13-23-18(6-3,24-14-8-5-2)17(19)22-16-12-10-9-11-15(16)20-21-22/h9-12,17H,4-8,13-14,19H2,1-3H3 |
| InChIKey | VDBZGFDWGQFFDX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.60 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|