C21H23ClN2O — CID 21283571
N,N,2-trimethyl-3-(2-phenylquinolin-4-yl)propanamide;hydrochloride (PubChem CID 21283571) has the molecular formula C21H23ClN2O and a molecular weight of 354.88 g/mol. Its IUPAC name is N,N,2-trimethyl-3-(2-phenylquinolin-4-yl)propanamide;hydrochloride.
| Compound Name | N,N,2-trimethyl-3-(2-phenylquinolin-4-yl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 21283571 |
| Molecular Formula | C21H23ClN2O |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N,N,2-trimethyl-3-(2-phenylquinolin-4-yl)propanamide;hydrochloride |
| SMILES | CC(Cc1cc(-c2ccccc2)nc2ccccc12)C(=O)N(C)C.Cl |
| InChI | InChI=1S/C21H22N2O.ClH/c1-15(21(24)23(2)3)13-17-14-20(16-9-5-4-6-10-16)22-19-12-8-7-11-18(17)19;/h4-12,14-15H,13H2,1-3H3;1H |
| InChIKey | UUOVEUNMKSHEMS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |