About N,N,2-trimethyl-3-(2-phenylquinolin-4-yl)propanamide;hydrochloride
N,N,2-trimethyl-3-(2-phenylquinolin-4-yl)propanamide;hydrochloride (PubChem CID 21283571) has the molecular formula C21H23ClN2O
and a molecular weight of 354.88 g/mol. Its IUPAC name is N,N,2-trimethyl-3-(2-phenylquinolin-4-yl)propanamide;hydrochloride.
Molecular Properties
| Compound Name | N,N,2-trimethyl-3-(2-phenylquinolin-4-yl)propanamide;hydrochloride |
| PubChem CID | 21283571 |
| Molecular Formula | C21H23ClN2O |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N,N,2-trimethyl-3-(2-phenylquinolin-4-yl)propanamide;hydrochloride |
| SMILES | CC(Cc1cc(-c2ccccc2)nc2ccccc12)C(=O)N(C)C.Cl |
| InChI | InChI=1S/C21H22N2O.ClH/c1-15(21(24)23(2)3)13-17-14-20(16-9-5-4-6-10-16)22-19-12-8-7-11-18(17)19;/h4-12,14-15H,13H2,1-3H3;1H |
| InChIKey | UUOVEUNMKSHEMS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N,2-trimethyl-3-(2-phenylquinolin-4-yl)propanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,2-trimethyl-3-(2-phenylquinolin-4-yl)propanamide;hydrochloride?
The IUPAC name of N,N,2-trimethyl-3-(2-phenylquinolin-4-yl)propanamide;hydrochloride (CID 21283571) is N,N,2-trimethyl-3-(2-phenylquinolin-4-yl)propanamide;hydrochloride.
What is the SMILES notation for N,N,2-trimethyl-3-(2-phenylquinolin-4-yl)propanamide;hydrochloride?
The canonical SMILES for N,N,2-trimethyl-3-(2-phenylquinolin-4-yl)propanamide;hydrochloride is CC(Cc1cc(-c2ccccc2)nc2ccccc12)C(=O)N(C)C.Cl.
What is the InChIKey of N,N,2-trimethyl-3-(2-phenylquinolin-4-yl)propanamide;hydrochloride?
The InChIKey is UUOVEUNMKSHEMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O.ClH/c1-15(21(24)23(2)3)13-17-14-20(16-9-5-4-6-10-16)22-19-12-8-7-11-18(17)19;/h4-12,14-15H,13H2,1-3H3;1H.
What are the key properties of N,N,2-trimethyl-3-(2-phenylquinolin-4-yl)propanamide;hydrochloride?
N,N,2-trimethyl-3-(2-phenylquinolin-4-yl)propanamide;hydrochloride has a molecular weight of 354.88 g/mol, XLogP of 4.59, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,2-trimethyl-3-(2-phenylquinolin-4-yl)propanamide;hydrochloride is sourced from PubChem (CID 21283571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).