propan-2-yl 2-phenyl-2-(2-phenylquinolin-4-yl)acetate

C26H23NO2 — CID 141464129

IUPACpropan-2-yl 2-phenyl-2-(2-phenylquinolin-4-yl)acetate
SMILESCC(C)OC(=O)C(c1ccccc1)c1cc(-c2ccccc2)nc2ccccc12
InChIInChI=1S/C26H23NO2/c1-18(2)29-26(28)25(20-13-7-4-8-14-20)22-17-24(19-11-5-3-6-12-19)27-23-16-10-9-15-21(22)23/h3-18,25H,1-2H3
InChIKeyHGDOPEFYHSRYBU-UHFFFAOYSA-N
MW381.48 g/mol
LogP5.99
Rot. Bonds5

About propan-2-yl 2-phenyl-2-(2-phenylquinolin-4-yl)acetate

propan-2-yl 2-phenyl-2-(2-phenylquinolin-4-yl)acetate (PubChem CID 141464129) has the molecular formula C26H23NO2 and a molecular weight of 381.48 g/mol. Its IUPAC name is propan-2-yl 2-phenyl-2-(2-phenylquinolin-4-yl)acetate.

Molecular Properties

Compound Namepropan-2-yl 2-phenyl-2-(2-phenylquinolin-4-yl)acetate
PubChem CID141464129
Molecular FormulaC26H23NO2
Molecular Weight381.48 g/mol
Exact Mass381.17
IUPAC Namepropan-2-yl 2-phenyl-2-(2-phenylquinolin-4-yl)acetate
SMILESCC(C)OC(=O)C(c1ccccc1)c1cc(-c2ccccc2)nc2ccccc12
InChIInChI=1S/C26H23NO2/c1-18(2)29-26(28)25(20-13-7-4-8-14-20)22-17-24(19-11-5-3-6-12-19)27-23-16-10-9-15-21(22)23/h3-18,25H,1-2H3
InChIKeyHGDOPEFYHSRYBU-UHFFFAOYSA-N
XLogP5.99
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms29
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500381.48
LogP ≤ 55.99
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze propan-2-yl 2-phenyl-2-(2-phenylquinolin-4-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of propan-2-yl 2-phenyl-2-(2-phenylquinolin-4-yl)acetate?
The IUPAC name of propan-2-yl 2-phenyl-2-(2-phenylquinolin-4-yl)acetate (CID 141464129) is propan-2-yl 2-phenyl-2-(2-phenylquinolin-4-yl)acetate.
What is the SMILES notation for propan-2-yl 2-phenyl-2-(2-phenylquinolin-4-yl)acetate?
The canonical SMILES for propan-2-yl 2-phenyl-2-(2-phenylquinolin-4-yl)acetate is CC(C)OC(=O)C(c1ccccc1)c1cc(-c2ccccc2)nc2ccccc12.
What is the InChIKey of propan-2-yl 2-phenyl-2-(2-phenylquinolin-4-yl)acetate?
The InChIKey is HGDOPEFYHSRYBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23NO2/c1-18(2)29-26(28)25(20-13-7-4-8-14-20)22-17-24(19-11-5-3-6-12-19)27-23-16-10-9-15-21(22)23/h3-18,25H,1-2H3.
What are the key properties of propan-2-yl 2-phenyl-2-(2-phenylquinolin-4-yl)acetate?
propan-2-yl 2-phenyl-2-(2-phenylquinolin-4-yl)acetate has a molecular weight of 381.48 g/mol, XLogP of 5.99, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-phenyl-2-(2-phenylquinolin-4-yl)acetate is sourced from PubChem (CID 141464129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).