C15H8Cl2F3NO2 — CID 21283750
(2,4-dichlorobenzenecarboximidoyl) 2-(trifluoromethyl)benzoate (PubChem CID 21283750) has the molecular formula C15H8Cl2F3NO2 and a molecular weight of 362.13 g/mol. Its IUPAC name is (2,4-dichlorobenzenecarboximidoyl) 2-(trifluoromethyl)benzoate.
| Compound Name | (2,4-dichlorobenzenecarboximidoyl) 2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 21283750 |
| Molecular Formula | C15H8Cl2F3NO2 |
| Molecular Weight | 362.13 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | (2,4-dichlorobenzenecarboximidoyl) 2-(trifluoromethyl)benzoate |
| SMILES | [H]/N=C(/OC(=O)c1ccccc1C(F)(F)F)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H8Cl2F3NO2/c16-8-5-6-10(12(17)7-8)13(21)23-14(22)9-3-1-2-4-11(9)15(18,19)20/h1-7,21H/b21-13+ |
| InChIKey | FTIWYVOBNWTHBG-FYJGNVAPSA-N |
| XLogP | 5.19 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.13 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|