About calcium;dihydroxy(oxo)silane;carbonate
calcium;dihydroxy(oxo)silane;carbonate (PubChem CID 21288142) has the molecular formula CH2CaO6Si
and a molecular weight of 178.18 g/mol. Its IUPAC name is calcium;dihydroxy(oxo)silane;carbonate.
Molecular Properties
| Compound Name | calcium;dihydroxy(oxo)silane;carbonate |
| PubChem CID | 21288142 |
| Molecular Formula | CH2CaO6Si |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 177.92 |
| IUPAC Name | calcium;dihydroxy(oxo)silane;carbonate |
| SMILES | O=C([O-])[O-].O=[Si](O)O.[Ca+2] |
| InChI | InChI=1S/CH2O3.Ca.H2O3Si/c2-1(3)4;;1-4(2)3/h(H2,2,3,4);;1-2H/q;+2;/p-2 |
| InChIKey | YIUPSTWUIZJNRG-UHFFFAOYSA-L |
| XLogP | -4.44 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | -4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze calcium;dihydroxy(oxo)silane;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;dihydroxy(oxo)silane;carbonate?
The IUPAC name of calcium;dihydroxy(oxo)silane;carbonate (CID 21288142) is calcium;dihydroxy(oxo)silane;carbonate.
What is the SMILES notation for calcium;dihydroxy(oxo)silane;carbonate?
The canonical SMILES for calcium;dihydroxy(oxo)silane;carbonate is O=C([O-])[O-].O=[Si](O)O.[Ca+2].
What is the InChIKey of calcium;dihydroxy(oxo)silane;carbonate?
The InChIKey is YIUPSTWUIZJNRG-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.Ca.H2O3Si/c2-1(3)4;;1-4(2)3/h(H2,2,3,4);;1-2H/q;+2;/p-2.
What are the key properties of calcium;dihydroxy(oxo)silane;carbonate?
calcium;dihydroxy(oxo)silane;carbonate has a molecular weight of 178.18 g/mol, XLogP of -4.44, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;dihydroxy(oxo)silane;carbonate is sourced from PubChem (CID 21288142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).