C17H15N3O4S — CID 21296125
2-[[5-ethyl-4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3-thiazol-2-yl]amino]-2-oxoacetic acid (PubChem CID 21296125) has the molecular formula C17H15N3O4S and a molecular weight of 357.39 g/mol. Its IUPAC name is 2-[[5-ethyl-4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3-thiazol-2-yl]amino]-2-oxoacetic acid.
| Compound Name | 2-[[5-ethyl-4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3-thiazol-2-yl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 21296125 |
| Molecular Formula | C17H15N3O4S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 2-[[5-ethyl-4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3-thiazol-2-yl]amino]-2-oxoacetic acid |
| SMILES | CCc1sc(NC(=O)C(=O)O)nc1-c1c(-c2ccccc2)noc1C |
| InChI | InChI=1S/C17H15N3O4S/c1-3-11-14(18-17(25-11)19-15(21)16(22)23)12-9(2)24-20-13(12)10-7-5-4-6-8-10/h4-8H,3H2,1-2H3,(H,22,23)(H,18,19,21) |
| InChIKey | NSDGSOQCNWUYQG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|