C29H29F3N2O4S — CID 21296441
diethyl 2,6-dimethyl-3-phenyl-4-(1,3-thiazol-2-yl)-2,4-dihydro-1H-pyridine-3,5-dicarboxylate;2-(trifluoromethyl)bicyclo[3.1.0]hexa-1,3,5-triene (PubChem CID 21296441) has the molecular formula C29H29F3N2O4S and a molecular weight of 558.62 g/mol. Its IUPAC name is diethyl 2,6-dimethyl-3-phenyl-4-(1,3-thiazol-2-yl)-2,4-dihydro-1H-pyridine-3,5-dicarboxylate;2-(trifluoromethyl)bicyclo[3.1.0]hexa-1,3,5-triene.
| Compound Name | diethyl 2,6-dimethyl-3-phenyl-4-(1,3-thiazol-2-yl)-2,4-dihydro-1H-pyridine-3,5-dicarboxylate;2-(trifluoromethyl)bicyclo[3.1.0]hexa-1,3,5-triene |
|---|---|
| PubChem CID | 21296441 |
| Molecular Formula | C29H29F3N2O4S |
| Molecular Weight | 558.62 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | diethyl 2,6-dimethyl-3-phenyl-4-(1,3-thiazol-2-yl)-2,4-dihydro-1H-pyridine-3,5-dicarboxylate;2-(trifluoromethyl)bicyclo[3.1.0]hexa-1,3,5-triene |
| SMILES | CCOC(=O)C1=C(C)NC(C)C(C(=O)OCC)(c2ccccc2)C1c1nccs1.FC(F)(F)c1ccc2cc1-2 |
| InChI | InChI=1S/C22H26N2O4S.C7H3F3/c1-5-27-20(25)17-14(3)24-15(4)22(21(26)28-6-2,16-10-8-7-9-11-16)18(17)19-23-12-13-29-19;8-7(9,10)6-2-1-4-3-5(4)6/h7-13,15,18,24H,5-6H2,1-4H3;1-3H |
| InChIKey | SVGPZGVOAWAPFH-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.62 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |