C26H26N2O5S — CID 21296594
bicyclo[3.1.0]hexa-1,3,5-trien-2-ol;dimethyl 2,6-dimethyl-2-phenyl-4-(1,3-thiazol-2-yl)-3,4-dihydro-1H-pyridine-3,5-dicarboxylate (PubChem CID 21296594) has the molecular formula C26H26N2O5S and a molecular weight of 478.57 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1,3,5-trien-2-ol;dimethyl 2,6-dimethyl-2-phenyl-4-(1,3-thiazol-2-yl)-3,4-dihydro-1H-pyridine-3,5-dicarboxylate.
| Compound Name | bicyclo[3.1.0]hexa-1,3,5-trien-2-ol;dimethyl 2,6-dimethyl-2-phenyl-4-(1,3-thiazol-2-yl)-3,4-dihydro-1H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 21296594 |
| Molecular Formula | C26H26N2O5S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | bicyclo[3.1.0]hexa-1,3,5-trien-2-ol;dimethyl 2,6-dimethyl-2-phenyl-4-(1,3-thiazol-2-yl)-3,4-dihydro-1H-pyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)(c2ccccc2)C(C(=O)OC)C1c1nccs1.Oc1ccc2cc1-2 |
| InChI | InChI=1S/C20H22N2O4S.C6H4O/c1-12-14(18(23)25-3)15(17-21-10-11-27-17)16(19(24)26-4)20(2,22-12)13-8-6-5-7-9-13;7-6-2-1-4-3-5(4)6/h5-11,15-16,22H,1-4H3;1-3,7H |
| InChIKey | XRQGQFLKXQREEI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |