C28H31N3O6S — CID 21296796
dimethyl 4-[[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-2,6-dimethyl-2-phenyl-3,4-dihydro-1H-pyridine-3,5-dicarboxylate (PubChem CID 21296796) has the molecular formula C28H31N3O6S and a molecular weight of 537.64 g/mol. Its IUPAC name is dimethyl 4-[[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-2,6-dimethyl-2-phenyl-3,4-dihydro-1H-pyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 4-[[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-2,6-dimethyl-2-phenyl-3,4-dihydro-1H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 21296796 |
| Molecular Formula | C28H31N3O6S |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | dimethyl 4-[[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-2,6-dimethyl-2-phenyl-3,4-dihydro-1H-pyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)(c2ccccc2)C(C(=O)OC)C1Nc1nc(-c2cc(OC)ccc2OC)cs1 |
| InChI | InChI=1S/C28H31N3O6S/c1-16-22(25(32)36-5)24(23(26(33)37-6)28(2,31-16)17-10-8-7-9-11-17)30-27-29-20(15-38-27)19-14-18(34-3)12-13-21(19)35-4/h7-15,23-24,31H,1-6H3,(H,29,30) |
| InChIKey | RVCUGHCFRVNRSQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |