C27H28N4O7S — CID 21296743
dimethyl 4-[[4-(4-methoxy-3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2,6-dimethyl-2-phenyl-3,4-dihydro-1H-pyridine-3,5-dicarboxylate (PubChem CID 21296743) has the molecular formula C27H28N4O7S and a molecular weight of 552.61 g/mol. Its IUPAC name is dimethyl 4-[[4-(4-methoxy-3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2,6-dimethyl-2-phenyl-3,4-dihydro-1H-pyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 4-[[4-(4-methoxy-3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2,6-dimethyl-2-phenyl-3,4-dihydro-1H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 21296743 |
| Molecular Formula | C27H28N4O7S |
| Molecular Weight | 552.61 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | dimethyl 4-[[4-(4-methoxy-3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2,6-dimethyl-2-phenyl-3,4-dihydro-1H-pyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)(c2ccccc2)C(C(=O)OC)C1Nc1nc(-c2ccc(OC)c([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C27H28N4O7S/c1-15-21(24(32)37-4)23(22(25(33)38-5)27(2,30-15)17-9-7-6-8-10-17)29-26-28-18(14-39-26)16-11-12-20(36-3)19(13-16)31(34)35/h6-14,22-23,30H,1-5H3,(H,28,29) |
| InChIKey | KCXBJAFXXUOGKC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 141.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.61 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|