C26H26BrCl2N3O4S — CID 88647668
dimethyl 2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-2,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyridine-3,5-dicarboxylate;hydrobromide (PubChem CID 88647668) has the molecular formula C26H26BrCl2N3O4S and a molecular weight of 627.39 g/mol. Its IUPAC name is dimethyl 2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-2,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyridine-3,5-dicarboxylate;hydrobromide.
| Compound Name | dimethyl 2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-2,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyridine-3,5-dicarboxylate;hydrobromide |
|---|---|
| PubChem CID | 88647668 |
| Molecular Formula | C26H26BrCl2N3O4S |
| Molecular Weight | 627.39 g/mol |
| Exact Mass | 625.02 |
| IUPAC Name | dimethyl 2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-2,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyridine-3,5-dicarboxylate;hydrobromide |
| SMILES | Br.COC(=O)C1=C(C)NC(C)(Nc2nc(-c3ccc(Cl)c(Cl)c3)cs2)C(C(=O)OC)C1c1ccccc1 |
| InChI | InChI=1S/C26H25Cl2N3O4S.BrH/c1-14-20(23(32)34-3)21(15-8-6-5-7-9-15)22(24(33)35-4)26(2,30-14)31-25-29-19(13-36-25)16-10-11-17(27)18(28)12-16;/h5-13,21-22,30H,1-4H3,(H,29,31);1H |
| InChIKey | YOHGCAHIBLXRFQ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.39 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |