C31H38BrN3O6S — CID 88647027
diethyl 2-[[4-(3,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]amino]-2,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyridine-3,5-dicarboxylate;hydrobromide (PubChem CID 88647027) has the molecular formula C31H38BrN3O6S and a molecular weight of 660.63 g/mol. Its IUPAC name is diethyl 2-[[4-(3,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]amino]-2,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyridine-3,5-dicarboxylate;hydrobromide.
| Compound Name | diethyl 2-[[4-(3,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]amino]-2,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyridine-3,5-dicarboxylate;hydrobromide |
|---|---|
| PubChem CID | 88647027 |
| Molecular Formula | C31H38BrN3O6S |
| Molecular Weight | 660.63 g/mol |
| Exact Mass | 659.17 |
| IUPAC Name | diethyl 2-[[4-(3,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]amino]-2,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyridine-3,5-dicarboxylate;hydrobromide |
| SMILES | Br.CCOC(=O)C1=C(C)NC(C)(Nc2nc(-c3ccc(OC)c(OC)c3)c(C)s2)C(C(=O)OCC)C1c1ccccc1 |
| InChI | InChI=1S/C31H37N3O6S.BrH/c1-8-39-28(35)24-18(3)33-31(5,26(29(36)40-9-2)25(24)20-13-11-10-12-14-20)34-30-32-27(19(4)41-30)21-15-16-22(37-6)23(17-21)38-7;/h10-17,25-26,33H,8-9H2,1-7H3,(H,32,34);1H |
| InChIKey | PEMISQQSJATNNO-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.63 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |