C29H33N3O6S — CID 88646600
dimethyl 3-[[4-(3,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]amino]-2,6-dimethyl-4-phenyl-2,4-dihydro-1H-pyridine-3,5-dicarboxylate (PubChem CID 88646600) has the molecular formula C29H33N3O6S and a molecular weight of 551.67 g/mol. Its IUPAC name is dimethyl 3-[[4-(3,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]amino]-2,6-dimethyl-4-phenyl-2,4-dihydro-1H-pyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 3-[[4-(3,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]amino]-2,6-dimethyl-4-phenyl-2,4-dihydro-1H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 88646600 |
| Molecular Formula | C29H33N3O6S |
| Molecular Weight | 551.67 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | dimethyl 3-[[4-(3,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]amino]-2,6-dimethyl-4-phenyl-2,4-dihydro-1H-pyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)C(Nc2nc(-c3ccc(OC)c(OC)c3)c(C)s2)(C(=O)OC)C1c1ccccc1 |
| InChI | InChI=1S/C29H33N3O6S/c1-16-23(26(33)37-6)24(19-11-9-8-10-12-19)29(18(3)30-16,27(34)38-7)32-28-31-25(17(2)39-28)20-13-14-21(35-4)22(15-20)36-5/h8-15,18,24,30H,1-7H3,(H,31,32) |
| InChIKey | VFAAITFSRWSJAH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.67 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |