C26H25FN2O4S — CID 21296518
dimethyl 2,6-dimethyl-2-phenyl-4-(1,3-thiazol-2-yl)-3,4-dihydro-1H-pyridine-3,5-dicarboxylate;2-fluorobicyclo[3.1.0]hexa-1,3,5-triene (PubChem CID 21296518) has the molecular formula C26H25FN2O4S and a molecular weight of 480.56 g/mol. Its IUPAC name is dimethyl 2,6-dimethyl-2-phenyl-4-(1,3-thiazol-2-yl)-3,4-dihydro-1H-pyridine-3,5-dicarboxylate;2-fluorobicyclo[3.1.0]hexa-1,3,5-triene.
| Compound Name | dimethyl 2,6-dimethyl-2-phenyl-4-(1,3-thiazol-2-yl)-3,4-dihydro-1H-pyridine-3,5-dicarboxylate;2-fluorobicyclo[3.1.0]hexa-1,3,5-triene |
|---|---|
| PubChem CID | 21296518 |
| Molecular Formula | C26H25FN2O4S |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | dimethyl 2,6-dimethyl-2-phenyl-4-(1,3-thiazol-2-yl)-3,4-dihydro-1H-pyridine-3,5-dicarboxylate;2-fluorobicyclo[3.1.0]hexa-1,3,5-triene |
| SMILES | COC(=O)C1=C(C)NC(C)(c2ccccc2)C(C(=O)OC)C1c1nccs1.Fc1ccc2cc1-2 |
| InChI | InChI=1S/C20H22N2O4S.C6H3F/c1-12-14(18(23)25-3)15(17-21-10-11-27-17)16(19(24)26-4)20(2,22-12)13-8-6-5-7-9-13;7-6-2-1-4-3-5(4)6/h5-11,15-16,22H,1-4H3;1-3H |
| InChIKey | PNZDLSJPLUQVRH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |