About 2-[1-(2-acetyloxyethyl)triazirin-1-ium-1-yl]ethyl acetate;benzene
2-[1-(2-acetyloxyethyl)triazirin-1-ium-1-yl]ethyl acetate;benzene (PubChem CID 21297812) has the molecular formula C14H20N3O4+
and a molecular weight of 294.33 g/mol. Its IUPAC name is 2-[1-(2-acetyloxyethyl)triazirin-1-ium-1-yl]ethyl acetate;benzene.
Molecular Properties
| Compound Name | 2-[1-(2-acetyloxyethyl)triazirin-1-ium-1-yl]ethyl acetate;benzene |
| PubChem CID | 21297812 |
| Molecular Formula | C14H20N3O4+ |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 2-[1-(2-acetyloxyethyl)triazirin-1-ium-1-yl]ethyl acetate;benzene |
| SMILES | CC(=O)OCC[N+]1(CCOC(C)=O)N=N1.c1ccccc1 |
| InChI | InChI=1S/C8H14N3O4.C6H6/c1-7(12)14-5-3-11(9-10-11)4-6-15-8(2)13;1-2-4-6-5-3-1/h3-6H2,1-2H3;1-6H/q+1; |
| InChIKey | RFPVDJDMSMALRC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(2-acetyloxyethyl)triazirin-1-ium-1-yl]ethyl acetate;benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2-acetyloxyethyl)triazirin-1-ium-1-yl]ethyl acetate;benzene?
The IUPAC name of 2-[1-(2-acetyloxyethyl)triazirin-1-ium-1-yl]ethyl acetate;benzene (CID 21297812) is 2-[1-(2-acetyloxyethyl)triazirin-1-ium-1-yl]ethyl acetate;benzene.
What is the SMILES notation for 2-[1-(2-acetyloxyethyl)triazirin-1-ium-1-yl]ethyl acetate;benzene?
The canonical SMILES for 2-[1-(2-acetyloxyethyl)triazirin-1-ium-1-yl]ethyl acetate;benzene is CC(=O)OCC[N+]1(CCOC(C)=O)N=N1.c1ccccc1.
What is the InChIKey of 2-[1-(2-acetyloxyethyl)triazirin-1-ium-1-yl]ethyl acetate;benzene?
The InChIKey is RFPVDJDMSMALRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N3O4.C6H6/c1-7(12)14-5-3-11(9-10-11)4-6-15-8(2)13;1-2-4-6-5-3-1/h3-6H2,1-2H3;1-6H/q+1;.
What are the key properties of 2-[1-(2-acetyloxyethyl)triazirin-1-ium-1-yl]ethyl acetate;benzene?
2-[1-(2-acetyloxyethyl)triazirin-1-ium-1-yl]ethyl acetate;benzene has a molecular weight of 294.33 g/mol, XLogP of 1.91, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2-acetyloxyethyl)triazirin-1-ium-1-yl]ethyl acetate;benzene is sourced from PubChem (CID 21297812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).